What is the 2-Bromofluorobenzene?

2-Bromofluorobenzene is clear colourless to light yellow liquid, while it's Molecular Formula is C6H4BrF. clear colourless to light yellow liquid 1-Bromo-2-fluorobenzene is used as a reactant with cyclopenta-1,3-diene to produce 1,4-dihydro-1,4-methano-naphthalene. This reaction will need reagent Mg, and solvent diethyl ether. The reaction time is 3 hours with the temperature of 20°C,

What is the CAS number for 2-Bromofluorobenzene?

The CAS number of 2-Bromofluorobenzene is 1072-85-1.

What is 2-Bromofluorobenzene (1072-85-1) used for?

2-Bromofluorobenzene (also known as o-bromofluorobenzene or 1-bromo-2-fluorobenzene) is a halogenated aromatic compound that can participate in halogen exchange reactions via radical or nucleophilic substitution pathways, as observed in Cu-HZSM-5 zeolite-catalyzed reactions. It reacts with hydroxyl radicals in aqueous solutions to form radical adducts or radical cations, depending on the pH conditions. Additionally, it can undergo electrophilic fluorination with molecular fluorine, though the reaction is highly reactive and unselective. 2-Bromofluorobenzene is also relevant in radical decarboxylative functionalization studies, though direct decarboxylative fluorination of its benzoic acid derivatives remains challenging under conventional conditions.InChI:InChI=1/C6H4BrF/c7-5-3-1-2-4-6(5)8/h1-4H

What is the 2-Bromofluorobenzene?

2-Bromofluorobenzene is clear colourless to light yellow liquid, while it's Molecular Formula is C6H4BrF. clear colourless to light yellow liquid 1-Bromo-2-fluorobenzene is used as a reactant with cyclopenta-1,3-diene to produce 1,4-dihydro-1,4-methano-naphthalene. This reaction will need reagent Mg, and solvent diethyl ether. The reaction time is 3 hours with the temperature of 20°C,

What is the CAS number for 2-Bromofluorobenzene?

The CAS number of 2-Bromofluorobenzene is 1072-85-1.

What is 2-Bromofluorobenzene (1072-85-1) used for?

2-Bromofluorobenzene (also known as o-bromofluorobenzene or 1-bromo-2-fluorobenzene) is a halogenated aromatic compound that can participate in halogen exchange reactions via radical or nucleophilic substitution pathways, as observed in Cu-HZSM-5 zeolite-catalyzed reactions. It reacts with hydroxyl radicals in aqueous solutions to form radical adducts or radical cations, depending on the pH conditions. Additionally, it can undergo electrophilic fluorination with molecular fluorine, though the reaction is highly reactive and unselective. 2-Bromofluorobenzene is also relevant in radical decarboxylative functionalization studies, though direct decarboxylative fluorination of its benzoic acid derivatives remains challenging under conventional conditions.InChI:InChI=1/C6H4BrF/c7-5-3-1-2-4-6(5)8/h1-4H