What is the 1-Bromo-2-chloro-4-fluorobenzene?

1-Bromo-2-chloro-4-fluorobenzene is Liquid, while it's Molecular Formula is C6H3BrClF. Liquid Used in Organic Synthesis: 1-Bromo-2-chloro-4-fluorobenzene is used as a synthetic intermediate for the preparation of various complex organic molecules. Its unique combination of halogen atoms allows for selective reactions and functional group transformations, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Used in Pharmaceutical Industry: In the pharmaceutical industry, 1-Bromo-2-chloro-4-fluorobenzene is used as a building block for the development of new drugs. Its reactivity and the ability to form diverse functional groups make it suitable for the synthesis of bioactive compounds with potential therapeutic applications. Used in Agrochemical Industry: 1-Bromo-2-chloro-4-fluorobenzene is employed as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique halogenated structure contributes to the development of effective and targeted agrochemical products. Used in Specialty Chemicals: In the specialty chemicals sector, 1-Bromo-2-chloro-4-fluorobenzene is utilized as a precursor for the production of various specialty chemicals, including dyes, pigments, and polymer additives. Its versatility in organic synthesis enables the creation of novel compounds with specific properties for various applications.

What is the CAS number for 1-Bromo-2-chloro-4-fluorobenzene?

The CAS number of 1-Bromo-2-chloro-4-fluorobenzene is 110407-59-5.

What is 1-Bromo-2-chloro-4-fluorobenzene (110407-59-5) used for?

1-Bromo-2-chloro-4-fluorobenzene is a halogenated aromatic compound characterized by the presence of bromine, chlorine, and fluorine atoms attached to a benzene ring. With the chemical formula C6H3BrClF and a molecular weight of 209.45 g/mol, this stable, strongly-colored liquid at room temperature is commonly utilized as an intermediate in the synthesis of complex organic molecules due to its unique reactivity profile.InChI:InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H

What is the 1-Bromo-2-chloro-4-fluorobenzene?

1-Bromo-2-chloro-4-fluorobenzene is Liquid, while it's Molecular Formula is C6H3BrClF. Liquid Used in Organic Synthesis: 1-Bromo-2-chloro-4-fluorobenzene is used as a synthetic intermediate for the preparation of various complex organic molecules. Its unique combination of halogen atoms allows for selective reactions and functional group transformations, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Used in Pharmaceutical Industry: In the pharmaceutical industry, 1-Bromo-2-chloro-4-fluorobenzene is used as a building block for the development of new drugs. Its reactivity and the ability to form diverse functional groups make it suitable for the synthesis of bioactive compounds with potential therapeutic applications. Used in Agrochemical Industry: 1-Bromo-2-chloro-4-fluorobenzene is employed as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique halogenated structure contributes to the development of effective and targeted agrochemical products. Used in Specialty Chemicals: In the specialty chemicals sector, 1-Bromo-2-chloro-4-fluorobenzene is utilized as a precursor for the production of various specialty chemicals, including dyes, pigments, and polymer additives. Its versatility in organic synthesis enables the creation of novel compounds with specific properties for various applications.

What is the CAS number for 1-Bromo-2-chloro-4-fluorobenzene?

The CAS number of 1-Bromo-2-chloro-4-fluorobenzene is 110407-59-5.

What is 1-Bromo-2-chloro-4-fluorobenzene (110407-59-5) used for?

1-Bromo-2-chloro-4-fluorobenzene is a halogenated aromatic compound characterized by the presence of bromine, chlorine, and fluorine atoms attached to a benzene ring. With the chemical formula C6H3BrClF and a molecular weight of 209.45 g/mol, this stable, strongly-colored liquid at room temperature is commonly utilized as an intermediate in the synthesis of complex organic molecules due to its unique reactivity profile.InChI:InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H

Product classification

Contact us

Tel：+86-371-87507775/55567972

Fax：+86-371-87507775

Phone：+86-13633837469/+86-15617786916/(wechat)

Email：sales@allgreenchem.com

Address：NO.10, Commercial Inner Ring Road，Zhengdong New District, Zhengzhou City, Henan Province

110407-59-5

Product Name：2-Chloro-4-fluorobromobenzene
Molecular Formula：C₆H₃BrClF
Purity：99%
Molecular Weight：209.445

Inquiry Add to cart

Product Details;

CasNo： 110407-59-5

Molecular Formula： C₆H₃BrClF

Appearance： Liquid

factory and supplier 110407-59-5 2-Chloro-4-fluorobromobenzene in stock

Molecular Formula:C6H3BrClF
Molecular Weight:209.445
Appearance/Colour:Liquid
Vapor Pressure:0.564mmHg at 25°C
Refractive Index:1.5525
Boiling Point:196.3 °C at 760 mmHg
Flash Point:72.5 °C
PSA：0.00000
Density:1.719 g/cm³
LogP:3.24160

1-Bromo-2-chloro-4-fluorobenzene(Cas 110407-59-5) Usage

General Description

1-Bromo-2-chloro-4-fluorobenzene is a halogenated aromatic compound often used in the field of organic synthesis. The chemical formula for this compound is C6H3BrClF and its molecular weight is 209.45 g/mol. It is a brominated, chlorinated, and fluorinated derivative of benzene, a stable, strongly-colored liquid at room temperature. Generally, it is used as an intermediate in the synthesis of other complex organic molecules. It is relatively inert, but it can act as a nucleophile in certain conditions. As with any halogenated organic compound, its handling and disposal must be done with care as it can potentially be harmful.

InChI:InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H

110407-59-5 Downstream products

941711-36-0
4-(2-chloro-4-fluorophenyl)pyridine
945422-88-8
4-(2-chloro-4-fluoro-phenyl)-2-methyl-piperazine-1-carboxylic acid tert-butyl ester
1070972-67-6
5-bromo-4-chloro-2-fluoro-benzenesulfonyl chloride
1189140-72-4
methyl 4-{[1-(4-bromo-3-chlorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl]methyl}benzoate

Relevant Products

4-Bromo-1-chloro-2-fluorobenzene
CAS：60811-18-9
2-Methyl-4-nitroaniline
CAS：99-52-5
Cyclohexyldiphenylphosphine
CAS：6372-42-5

DIBASIC ESTER

2,5-Dimethoxy-Beta-Nitrostyrene

5-Bromo-2-fluoro-m-xylene

Decafluorbiphenyl

1-Bromo-4-Cyclohexylbenzene

Home

About us

Products

Electronic chemicals

Pharmaceutical intermediates

Ionic liquid

Fluorinated chemicals

Others

Customized synthesis

Quality Control

News

Contact Us