What is the 2-Bromo-1-chloro-4-fluorobenzene?

2-Bromo-1-chloro-4-fluorobenzene is clear colorless liquid, while it's Molecular Formula is C 6 H 3 BrClF. clear colorless liquid Used in Chemical Research: 2-Bromo-1-chloro-4-fluorobenzene is utilized as a research compound for studying its chemical properties and reactivity. Its stability and unique structure make it a valuable subject for scientific investigation. Used in Organic Synthesis: In the field of organic synthesis, 2-Bromo-1-chloro-4-fluorobenzene is employed as a key intermediate or building block for the synthesis of more complex organic molecules. Its reactivity towards nucleophilic substitution reactions allows for the creation of a variety of derivatives with potential applications in different industries. Used in Pharmaceutical Industry: 2-Bromo-1-chloro-4-fluorobenzene is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications. Used in Material Science: In material science, 2-Bromo-1-chloro-4-fluorobenzene may be used as a component in the development of new materials with specific properties, such as improved stability or reactivity, which can be beneficial in various applications.

What is the CAS number for 2-Bromo-1-chloro-4-fluorobenzene?

The CAS number of 2-Bromo-1-chloro-4-fluorobenzene is 201849-15-2.

What is 2-Bromo-1-chloro-4-fluorobenzene (201849-15-2) used for?

2-Bromo-1-chloro-4-fluorobenzene is a synthetic organic compound that belongs to the class of organohalides. It is a benzene derivative characterized by the presence of one carbon atom bonded to bromine, one to chlorine, and another to fluorine. 2-Bromo-1-chloro-4-fluorobenzene is known for its chemical stability and unreactive nature due to the halogens it contains. It typically appears as a colorless liquid or white crystalline solid.InChI:InChI=1/C7H5BrClF/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3

What is the 2-Bromo-1-chloro-4-fluorobenzene?

2-Bromo-1-chloro-4-fluorobenzene is clear colorless liquid, while it's Molecular Formula is C 6 H 3 BrClF. clear colorless liquid Used in Chemical Research: 2-Bromo-1-chloro-4-fluorobenzene is utilized as a research compound for studying its chemical properties and reactivity. Its stability and unique structure make it a valuable subject for scientific investigation. Used in Organic Synthesis: In the field of organic synthesis, 2-Bromo-1-chloro-4-fluorobenzene is employed as a key intermediate or building block for the synthesis of more complex organic molecules. Its reactivity towards nucleophilic substitution reactions allows for the creation of a variety of derivatives with potential applications in different industries. Used in Pharmaceutical Industry: 2-Bromo-1-chloro-4-fluorobenzene is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications. Used in Material Science: In material science, 2-Bromo-1-chloro-4-fluorobenzene may be used as a component in the development of new materials with specific properties, such as improved stability or reactivity, which can be beneficial in various applications.

What is the CAS number for 2-Bromo-1-chloro-4-fluorobenzene?

The CAS number of 2-Bromo-1-chloro-4-fluorobenzene is 201849-15-2.

What is 2-Bromo-1-chloro-4-fluorobenzene (201849-15-2) used for?

2-Bromo-1-chloro-4-fluorobenzene is a synthetic organic compound that belongs to the class of organohalides. It is a benzene derivative characterized by the presence of one carbon atom bonded to bromine, one to chlorine, and another to fluorine. 2-Bromo-1-chloro-4-fluorobenzene is known for its chemical stability and unreactive nature due to the halogens it contains. It typically appears as a colorless liquid or white crystalline solid.InChI:InChI=1/C7H5BrClF/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3

Product classification

Contact us

Tel：+86-371-87507775/55567972

Fax：+86-371-87507775

Phone：+86-13633837469/+86-15617786916/(wechat)

Email：sales@allgreenchem.com

Address：NO.10, Commercial Inner Ring Road，Zhengdong New District, Zhengzhou City, Henan Province

201849-15-2

Product Name：2-Bromo-1-chloro-4-fluorobenzene
Molecular Formula：C₆H₃BrClF
Purity：99%
Molecular Weight：209.445

Inquiry Add to cart

Product Details;

CasNo： 201849-15-2

Molecular Formula： C₆H₃BrClF

Appearance： clear colorless liquid

factory and supplier 201849-15-2 2-Bromo-1-chloro-4-fluorobenzene in stock

Molecular Formula:C₆H₃BrClF
Molecular Weight:209.445
Appearance/Colour:clear colorless liquid
Vapor Pressure:0.102mmHg at 25°C
Refractive Index:1.545
Boiling Point:202.1 °C at 760 mmHg
Flash Point:76 °C
PSA：0.00000
Density:1.719 g/cm³
LogP:3.24160

2-Bromo-1-chloro-4-fluorobenzene(Cas 201849-15-2) Usage

General Description

2-Bromo-1-chloro-4-fluorobenzene is a synthetic organic compound that falls under the category of organohalides. It is a benzene derivative with one carbon bonded to bromine, one to chlorine, and another to fluorine. The compound tends to be chemically stable, being unreactive in nature due to the presence of the halogens. It is mainly used in chemical research and various types of organic synthesis because of its reactivity towards nucleophilic substitution reactions. Not much information is provided about its toxicity or environmental impact, so proper safety measures should be taken while handling. Its exact physical properties such as melting point, boiling point, and density may also vary. It generally appears as a colorless liquid or white crystalline solid.

InChI:InChI=1/C7H5BrClF/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3

201849-15-2 Downstream products

1246749-89-2
tert-butyl (5-{3-[5-(2-chloro-5-fluorophenyl)hexahydropyrrolo[3,4-c]pyrrol-2(1H)-yl]isoxazol-5-yl}-2H-tetrazol-2-yl)acetate
1357179-37-3
C₂₂H₂₅ClFN₇O₃
1437715-67-7
tert-butyl 4-(((2-(2-chloro-5-methoxy-4-nitrophen)ethyl)amino)methyl)piperidine-1-carboxylate
1437715-75-7
tert-butyl 4-((((tert-butoxy)carbonyl)(2-(2-chloro-5-methoxy-4-nitrophenyl)ethyl)amino)methyl)piperidine-1-carboxylate

Relevant Products

4-Bromo-1-chloro-2-fluorobenzene
CAS：60811-18-9
Methyldiphenylphosphine oxide
CAS：2129-89-7
Dibenzothiophene-2-boronic Acid
CAS：668983-97-9

DIBASIC ESTER

2,5-Dimethoxy-Beta-Nitrostyrene

5-Bromo-2-fluoro-m-xylene

Decafluorbiphenyl

1-Bromo-4-Cyclohexylbenzene

Home

About us

Products

Electronic chemicals

Pharmaceutical intermediates

Ionic liquid

Fluorinated chemicals

Others

Customized synthesis

Quality Control

News

Contact Us